| Name | butyl undec-10-enoate |
| Synonyms | FEMA 2216 BUTYL UNDECYLENATE BUTYL UNDECYLENOATE BUTYL 10-UNDECENOATE N-BUTYL UNDECYLENATE butyl undec-10-enoate Butyl 10-undecylenate 10-Undecenoicacid,butylester 10-Undecenoic Acid Butyl Ester |
| CAS | 109-42-2 |
| EINECS | 203-670-4 |
| InChI | InChI=1/C15H28O2/c1-3-5-7-8-9-10-11-12-13-15(16)17-14-6-4-2/h3H,1,4-14H2,2H3 |
| Molecular Formula | C15H28O2 |
| Molar Mass | 240.38 |
| Density | 0.875g/cm3 |
| Melting Point | 1.3°C (estimate) |
| Boling Point | 301.7°C at 760 mmHg |
| Flash Point | 128°C |
| Vapor Presure | 0.00104mmHg at 25°C |
| Storage Condition | 2-8°C |
| Refractive Index | 1.444 |
| Physical and Chemical Properties | Chemical properties colorless to light yellow liquid. It has a cream and wine-like aroma. Boiling point 125~128 ℃(400Pa) or 252 ℃. |
| Use | Uses Spices for food. Mainly used to prepare cream and wine flavors. |
| WGK Germany | 2 |
| RTECS | YQ2978000 |
| Raw Materials | 1-Butanol Undecenoic acid |
| FEMA | 2216 | BUTYL 10-UNDECENOATE |
| JECFA Number | 344 |
| EPA chemical information | 10-Undecenoic acid, butyl ester (109-42-2) |
Toxicity
GRAS(FEMA).
use limited
FEMA(mg/kg): drink 0.90; Cold drink 2.0; Candy 6.6; 7.8 of baked products; Gum candy 0.40~60.0; Alcohol-containing beverage 5.0; Coating 5.0.
FDA,& sect;172.515: limited to appropriate amount.
Production method
It is made by heating and boiling 10-undecanoic acid and n-butanol in the presence of concentrated sulfuric acid (or in benzene solution) for esterification.
category
Toxic substances
Toxicity classification
low toxicity
Acute toxicity
oral-rat LD50: 5000 mg/kg
Stimulus data
skin-rabbit 500 mg/24 hours mild
flammability hazard characteristics
Thermal decomposition spicy stimulation smoke
storage and transportation features
Warehouse ventilation low temperature drying
Fire extinguishing agent
Water, dry powder, carbon dioxide, foam